| Name | 2,4-dichloro-6-methylthieno[3,2-d]pyrimidine |
| Synonyms | 2,4-Dichloro-6-methylthie... 2,4-DICHLORO-6-METHYLTHIENO[3,2-D]PYRIMIDINE 2,4-dichloro-6-methylthieno[3,2-d]pyrimidine Thieno[3,2-d]pyrimidine, 2,4-dichloro-6-methyl- 2,4-Dichloro-6-Methylthieno[3,2-d]Pyrimidine 2,4-DICHLORO-6-METHYLTHIENO[3,2-D]PYRIMIDINE |
| CAS | 35265-82-8 |
| InChI | InChI=1S/C7H4Cl2N2S/c1-3-2-4-5(12-3)6(8)11-7(9)10-4/h2H,1H3 |
| Molecular Formula | C7H4Cl2N2S |
| Molar Mass | 219.09 |
| Density | 1.568±0.06 g/cm3(Predicted) |
| Boling Point | 293.1±22.0 °C(Predicted) |
| pKa | -0.43±0.40(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| application | 2, 4-dichloro-6-methylthieno [3,2-D] pyrimidine can be used as a pharmaceutical intermediate and an organic synthesis intermediate, and can be used to prepare FLT3 and FGFR kinase inhibitors. |